C14H22O2 — CID 142226796
ethane;(3E,5E,7E,9Z)-8-hydroxy-5-methylundeca-3,5,7,9-tetraen-2-one (PubChem CID 142226796) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;(3E,5E,7E,9Z)-8-hydroxy-5-methylundeca-3,5,7,9-tetraen-2-one.
| Compound Name | ethane;(3E,5E,7E,9Z)-8-hydroxy-5-methylundeca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 142226796 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethane;(3E,5E,7E,9Z)-8-hydroxy-5-methylundeca-3,5,7,9-tetraen-2-one |
| SMILES | C/C=C\C(O)=C/C=C(C)/C=C/C(C)=O.CC |
| InChI | InChI=1S/C12H16O2.C2H6/c1-4-5-12(14)9-7-10(2)6-8-11(3)13;1-2/h4-9,14H,1-3H3;1-2H3/b5-4-,8-6+,10-7+,12-9+; |
| InChIKey | NRDPEYSEKHCLGJ-HRPUFXJKSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|