C11H19F — CID 144635902
ethane;(2E,4Z,6E)-2-fluoro-5-methylocta-2,4,6-triene (PubChem CID 144635902) has the molecular formula C11H19F and a molecular weight of 170.27 g/mol. Its IUPAC name is ethane;(2E,4Z,6E)-2-fluoro-5-methylocta-2,4,6-triene.
| Compound Name | ethane;(2E,4Z,6E)-2-fluoro-5-methylocta-2,4,6-triene |
|---|---|
| PubChem CID | 144635902 |
| Molecular Formula | C11H19F |
| Molecular Weight | 170.27 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | ethane;(2E,4Z,6E)-2-fluoro-5-methylocta-2,4,6-triene |
| SMILES | C/C=C/C(C)=C\C=C(/C)F.CC |
| InChI | InChI=1S/C9H13F.C2H6/c1-4-5-8(2)6-7-9(3)10;1-2/h4-7H,1-3H3;1-2H3/b5-4+,8-6-,9-7+; |
| InChIKey | XHZJHMWJSMNBBQ-DLNANRRGSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|