C28H34N2 — CID 145060065
(2E,4Z,6Z)-2-ethenyl-5-methyl-N-[(3E,5E)-6-methyl-7-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]iminohepta-1,3,5-trien-3-yl]octa-2,4,6-trien-1-imine (PubChem CID 145060065) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2E,4Z,6Z)-2-ethenyl-5-methyl-N-[(3E,5E)-6-methyl-7-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]iminohepta-1,3,5-trien-3-yl]octa-2,4,6-trien-1-imine.
| Compound Name | (2E,4Z,6Z)-2-ethenyl-5-methyl-N-[(3E,5E)-6-methyl-7-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]iminohepta-1,3,5-trien-3-yl]octa-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 145060065 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (2E,4Z,6Z)-2-ethenyl-5-methyl-N-[(3E,5E)-6-methyl-7-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]iminohepta-1,3,5-trien-3-yl]octa-2,4,6-trien-1-imine |
| SMILES | C=C/C(C)=C\C=C(C=C)\N=C\C(C)=C\C=C(C=C)\N=C\C(C=C)=C\C=C(C)/C=C\C |
| InChI | InChI=1S/C28H34N2/c1-9-14-24(7)15-18-26(11-3)22-30-28(13-5)20-17-25(8)21-29-27(12-4)19-16-23(6)10-2/h9-22H,2-5H2,1,6-8H3/b14-9-,23-16-,24-15-,25-17+,26-18+,27-19+,28-20+,29-21+,30-22+ |
| InChIKey | DICCJOIBERZEQP-BIDIUPDXSA-N |
| XLogP | 7.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|