C15H28 — CID 145084506
(3Z)-3,6-dimethylhepta-1,3,5-triene;ethane;2-methylprop-1-ene (PubChem CID 145084506) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (3Z)-3,6-dimethylhepta-1,3,5-triene;ethane;2-methylprop-1-ene.
| Compound Name | (3Z)-3,6-dimethylhepta-1,3,5-triene;ethane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145084506 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (3Z)-3,6-dimethylhepta-1,3,5-triene;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C/C(C)=C\C=C(C)C.CC |
| InChI | InChI=1S/C9H14.C4H8.C2H6/c1-5-9(4)7-6-8(2)3;1-4(2)3;1-2/h5-7H,1H2,2-4H3;1H2,2-3H3;1-2H3/b9-7-;; |
| InChIKey | GRXUYUSHWYVMEB-COUYFGMESA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|