C10H15N — CID 144989388
(3E)-3-ethenyl-6-methylhepta-1,3,5-trien-2-amine (PubChem CID 144989388) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3E)-3-ethenyl-6-methylhepta-1,3,5-trien-2-amine.
| Compound Name | (3E)-3-ethenyl-6-methylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144989388 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3E)-3-ethenyl-6-methylhepta-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C\C=C(C)C)C(=C)N |
| InChI | InChI=1S/C10H15N/c1-5-10(9(4)11)7-6-8(2)3/h5-7H,1,4,11H2,2-3H3/b10-7+ |
| InChIKey | ZBNRLBZCYPIFRN-JXMROGBWSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|