C12H18O — CID 142078269
(4E)-4-ethenyl-2,7-dimethylocta-4,6-dien-3-one (PubChem CID 142078269) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (4E)-4-ethenyl-2,7-dimethylocta-4,6-dien-3-one.
| Compound Name | (4E)-4-ethenyl-2,7-dimethylocta-4,6-dien-3-one |
|---|---|
| PubChem CID | 142078269 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (4E)-4-ethenyl-2,7-dimethylocta-4,6-dien-3-one |
| SMILES | C=C/C(=C\C=C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C12H18O/c1-6-11(8-7-9(2)3)12(13)10(4)5/h6-8,10H,1H2,2-5H3/b11-8+ |
| InChIKey | LPGHRKLGEGOXEU-DHZHZOJOSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|