C12H17N — CID 156706976
(2Z,5E)-5-ethenyl-8-methylnona-2,5,7-trien-4-imine (PubChem CID 156706976) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (2Z,5E)-5-ethenyl-8-methylnona-2,5,7-trien-4-imine.
| Compound Name | (2Z,5E)-5-ethenyl-8-methylnona-2,5,7-trien-4-imine |
|---|---|
| PubChem CID | 156706976 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2Z,5E)-5-ethenyl-8-methylnona-2,5,7-trien-4-imine |
| SMILES | [H]N=C(/C=C\C)/C(C=C)=C/C=C(C)C |
| InChI | InChI=1S/C12H17N/c1-5-7-12(13)11(6-2)9-8-10(3)4/h5-9,13H,2H2,1,3-4H3/b7-5-,11-9+,13-12+ |
| InChIKey | UMLHQUQFASAGFG-QNQNVNOOSA-N |
| XLogP | 3.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|