C16H22 — CID 143312341
(2Z,4E,6E,8Z)-6-ethenyl-4-methyl-5-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraene (PubChem CID 143312341) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (2Z,4E,6E,8Z)-6-ethenyl-4-methyl-5-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraene.
| Compound Name | (2Z,4E,6E,8Z)-6-ethenyl-4-methyl-5-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 143312341 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2Z,4E,6E,8Z)-6-ethenyl-4-methyl-5-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraene |
| SMILES | C=CC(=C\C=C/C)/C(/C=C\C)=C(C)/C=C\C |
| InChI | InChI=1S/C16H22/c1-6-10-13-15(9-4)16(12-8-3)14(5)11-7-2/h6-13H,4H2,1-3,5H3/b10-6-,11-7-,12-8-,15-13+,16-14+ |
| InChIKey | ZAURIBRCLZQQKN-BIXRGDNSSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|