C15H18 — CID 174021215
(3Z,5Z,6Z)-5-but-3-en-2-ylidene-4-ethenylnona-1,3,6,8-tetraene (PubChem CID 174021215) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is (3Z,5Z,6Z)-5-but-3-en-2-ylidene-4-ethenylnona-1,3,6,8-tetraene.
| Compound Name | (3Z,5Z,6Z)-5-but-3-en-2-ylidene-4-ethenylnona-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 174021215 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (3Z,5Z,6Z)-5-but-3-en-2-ylidene-4-ethenylnona-1,3,6,8-tetraene |
| SMILES | C=C/C=C\C(=C(/C)C=C)\C(C=C)=C\C=C |
| InChI | InChI=1S/C15H18/c1-6-10-12-15(13(5)8-3)14(9-4)11-7-2/h6-12H,1-4H2,5H3/b12-10-,14-11-,15-13- |
| InChIKey | DQLOBJXIIPYTAH-NFIFNRMFSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|