C12H17N — CID 170231380
(3E,5Z)-3-methyl-N-prop-1-en-2-ylocta-1,3,5,7-tetraen-4-amine (PubChem CID 170231380) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-N-prop-1-en-2-ylocta-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-3-methyl-N-prop-1-en-2-ylocta-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 170231380 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3E,5Z)-3-methyl-N-prop-1-en-2-ylocta-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(NC(=C)C)=C(\C)C=C |
| InChI | InChI=1S/C12H17N/c1-6-8-9-12(11(5)7-2)13-10(3)4/h6-9,13H,1-3H2,4-5H3/b9-8-,12-11+ |
| InChIKey | BGZLJCYMNJNEON-UONSLQGUSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|