C19H22 — CID 143476273
(3Z,7Z,11Z)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene (PubChem CID 143476273) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is (3Z,7Z,11Z)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene.
| Compound Name | (3Z,7Z,11Z)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
|---|---|
| PubChem CID | 143476273 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (3Z,7Z,11Z)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C\C(=C)C(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C19H22/c1-8-9-10-16(4)18(6)13-14-19(7)17(5)12-11-15(2)3/h8-14H,1-2,4-7H2,3H3/b10-9-,12-11-,14-13- |
| InChIKey | ZVPFEBDBCUROOV-HLASKAJKSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|