C14H16O2 — CID 144579489
(2E,5Z)-3,4-dimethylidene-2-(2-methylprop-2-enylidene)octa-5,7-dienoic acid (PubChem CID 144579489) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2E,5Z)-3,4-dimethylidene-2-(2-methylprop-2-enylidene)octa-5,7-dienoic acid.
| Compound Name | (2E,5Z)-3,4-dimethylidene-2-(2-methylprop-2-enylidene)octa-5,7-dienoic acid |
|---|---|
| PubChem CID | 144579489 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2E,5Z)-3,4-dimethylidene-2-(2-methylprop-2-enylidene)octa-5,7-dienoic acid |
| SMILES | C=C/C=C\C(=C)C(=C)/C(=C\C(=C)C)C(=O)O |
| InChI | InChI=1S/C14H16O2/c1-6-7-8-11(4)12(5)13(14(15)16)9-10(2)3/h6-9H,1-2,4-5H2,3H3,(H,15,16)/b8-7-,13-9+ |
| InChIKey | HNWIDTKBGBGXBF-XTYDYKDCSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|