C14H17NS — CID 166885740
(3Z,7Z,8E)-7-ethylidene-5,6-dimethylidene-8-thionitrosodeca-1,3,8-triene (PubChem CID 166885740) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is (3Z,7Z,8E)-7-ethylidene-5,6-dimethylidene-8-thionitrosodeca-1,3,8-triene.
| Compound Name | (3Z,7Z,8E)-7-ethylidene-5,6-dimethylidene-8-thionitrosodeca-1,3,8-triene |
|---|---|
| PubChem CID | 166885740 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3Z,7Z,8E)-7-ethylidene-5,6-dimethylidene-8-thionitrosodeca-1,3,8-triene |
| SMILES | C=C/C=C\C(=C)C(=C)C(=C/C)/C(=C\C)N=S |
| InChI | InChI=1S/C14H17NS/c1-6-9-10-11(4)12(5)13(7-2)14(8-3)15-16/h6-10H,1,4-5H2,2-3H3/b10-9-,13-7-,14-8+ |
| InChIKey | FLRDATKQRRSMHS-YXGSLONLSA-N |
| XLogP | 4.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|