C19H32O — CID 144870179
(2Z,7Z)-4,6-dimethylidenedeca-2,7,9-trien-5-one;ethane;prop-1-ene (PubChem CID 144870179) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (2Z,7Z)-4,6-dimethylidenedeca-2,7,9-trien-5-one;ethane;prop-1-ene.
| Compound Name | (2Z,7Z)-4,6-dimethylidenedeca-2,7,9-trien-5-one;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144870179 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (2Z,7Z)-4,6-dimethylidenedeca-2,7,9-trien-5-one;ethane;prop-1-ene |
| SMILES | C=C/C=C\C(=C)C(=O)C(=C)/C=C\C.C=CC.CC.CC |
| InChI | InChI=1S/C12H14O.C3H6.2C2H6/c1-5-7-9-11(4)12(13)10(3)8-6-2;1-3-2;2*1-2/h5-9H,1,3-4H2,2H3;3H,1H2,2H3;2*1-2H3/b8-6-,9-7-;;; |
| InChIKey | LQVBHZLQBCMKHB-VVUCZUPNSA-N |
| XLogP | 6.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|