C13H24 — CID 145140668
(5Z)-3,4-dimethylidenehepta-1,5-diene;ethane (PubChem CID 145140668) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane.
| Compound Name | (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane |
|---|---|
| PubChem CID | 145140668 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane |
| SMILES | C=CC(=C)C(=C)/C=C\C.CC.CC |
| InChI | InChI=1S/C9H12.2C2H6/c1-5-7-9(4)8(3)6-2;2*1-2/h5-7H,2-4H2,1H3;2*1-2H3/b7-5-;; |
| InChIKey | PGVNTEQEWGSRLJ-MWKZNRQPSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|