About (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane
(5Z)-3,4-dimethylidenehepta-1,5-diene;ethane (PubChem CID 143166172) has the molecular formula C15H30
and a molecular weight of 210.41 g/mol. Its IUPAC name is (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane.
Molecular Properties
| Compound Name | (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane |
| PubChem CID | 143166172 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.41 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane |
| SMILES | C=CC(=C)C(=C)/C=C\C.CC.CC.CC |
| InChI | InChI=1S/C9H12.3C2H6/c1-5-7-9(4)8(3)6-2;3*1-2/h5-7H,2-4H2,1H3;3*1-2H3/b7-5-;;; |
| InChIKey | BVJKAGGYVVFVPD-PQIWAGTOSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.41 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane?
The IUPAC name of (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane (CID 143166172) is (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane.
What is the SMILES notation for (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane?
The canonical SMILES for (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane is C=CC(=C)C(=C)/C=C\C.CC.CC.CC.
What is the InChIKey of (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane?
The InChIKey is BVJKAGGYVVFVPD-PQIWAGTOSA-N. The full InChI is InChI=1S/C9H12.3C2H6/c1-5-7-9(4)8(3)6-2;3*1-2/h5-7H,2-4H2,1H3;3*1-2H3/b7-5-;;;.
What are the key properties of (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane?
(5Z)-3,4-dimethylidenehepta-1,5-diene;ethane has a molecular weight of 210.41 g/mol, XLogP of 5.94, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3,4-dimethylidenehepta-1,5-diene;ethane is sourced from PubChem (CID 143166172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).