C17H28O — CID 144596817
(2Z,4E,6Z)-4,5-bis(ethenyl)octa-2,4,6-triene;ethane;propan-2-one (PubChem CID 144596817) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (2Z,4E,6Z)-4,5-bis(ethenyl)octa-2,4,6-triene;ethane;propan-2-one.
| Compound Name | (2Z,4E,6Z)-4,5-bis(ethenyl)octa-2,4,6-triene;ethane;propan-2-one |
|---|---|
| PubChem CID | 144596817 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (2Z,4E,6Z)-4,5-bis(ethenyl)octa-2,4,6-triene;ethane;propan-2-one |
| SMILES | C=CC(/C=C\C)=C(C=C)\C=C/C.CC.CC(C)=O |
| InChI | InChI=1S/C12H16.C3H6O.C2H6/c1-5-9-11(7-3)12(8-4)10-6-2;1-3(2)4;1-2/h5-10H,3-4H2,1-2H3;1-2H3;1-2H3/b9-5-,10-6-,12-11+;; |
| InChIKey | VGGTXLBDUVUXMF-AVOHQKKXSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|