C13H22 — CID 145032190
ethane;(3E,5Z)-4-ethenyl-3-ethylhepta-1,3,5-triene (PubChem CID 145032190) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-ethenyl-3-ethylhepta-1,3,5-triene.
| Compound Name | ethane;(3E,5Z)-4-ethenyl-3-ethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 145032190 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | ethane;(3E,5Z)-4-ethenyl-3-ethylhepta-1,3,5-triene |
| SMILES | C=CC(/C=C\C)=C(\C=C)CC.CC |
| InChI | InChI=1S/C11H16.C2H6/c1-5-9-11(8-4)10(6-2)7-3;1-2/h5-6,8-9H,2,4,7H2,1,3H3;1-2H3/b9-5-,11-10-; |
| InChIKey | RYJMSMNRISRACO-VGDSCVMISA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|