C18H36 — CID 162432866
(3Z,5Z)-3,4-diethylocta-1,3,5,7-tetraene;ethane (PubChem CID 162432866) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is (3Z,5Z)-3,4-diethylocta-1,3,5,7-tetraene;ethane.
| Compound Name | (3Z,5Z)-3,4-diethylocta-1,3,5,7-tetraene;ethane |
|---|---|
| PubChem CID | 162432866 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | (3Z,5Z)-3,4-diethylocta-1,3,5,7-tetraene;ethane |
| SMILES | C=C/C=C\C(CC)=C(/C=C)CC.CC.CC.CC |
| InChI | InChI=1S/C12H18.3C2H6/c1-5-9-10-12(8-4)11(6-2)7-3;3*1-2/h5-6,9-10H,1-2,7-8H2,3-4H3;3*1-2H3/b10-9-,12-11+;;; |
| InChIKey | PAUNRKKRHZTUQO-TWZJOZQQSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|