C18H38 — CID 144652026
ethane;(3Z,5E)-5-ethyl-6-methylnona-1,3,5-triene (PubChem CID 144652026) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-ethyl-6-methylnona-1,3,5-triene.
| Compound Name | ethane;(3Z,5E)-5-ethyl-6-methylnona-1,3,5-triene |
|---|---|
| PubChem CID | 144652026 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | ethane;(3Z,5E)-5-ethyl-6-methylnona-1,3,5-triene |
| SMILES | C=C/C=C\C(CC)=C(/C)CCC.CC.CC.CC |
| InChI | InChI=1S/C12H20.3C2H6/c1-5-8-10-12(7-3)11(4)9-6-2;3*1-2/h5,8,10H,1,6-7,9H2,2-4H3;3*1-2H3/b10-8-,12-11+;;; |
| InChIKey | ZCCVODYHRLTVHL-HVOGBEABSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|