About (Z)-3,4-dimethylhept-3-ene;ethane;propane
(Z)-3,4-dimethylhept-3-ene;ethane;propane (PubChem CID 144674690) has the molecular formula C14H32
and a molecular weight of 200.41 g/mol. Its IUPAC name is (Z)-3,4-dimethylhept-3-ene;ethane;propane.
Molecular Properties
| Compound Name | (Z)-3,4-dimethylhept-3-ene;ethane;propane |
| PubChem CID | 144674690 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | (Z)-3,4-dimethylhept-3-ene;ethane;propane |
| SMILES | CC.CCC.CCC/C(C)=C(/C)CC |
| InChI | InChI=1S/C9H18.C3H8.C2H6/c1-5-7-9(4)8(3)6-2;1-3-2;1-2/h5-7H2,1-4H3;3H2,1-2H3;1-2H3/b9-8-;; |
| InChIKey | IUNNIYGROFWIDC-ULDSSAIZSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-dimethylhept-3-ene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-dimethylhept-3-ene;ethane;propane?
The IUPAC name of (Z)-3,4-dimethylhept-3-ene;ethane;propane (CID 144674690) is (Z)-3,4-dimethylhept-3-ene;ethane;propane.
What is the SMILES notation for (Z)-3,4-dimethylhept-3-ene;ethane;propane?
The canonical SMILES for (Z)-3,4-dimethylhept-3-ene;ethane;propane is CC.CCC.CCC/C(C)=C(/C)CC.
What is the InChIKey of (Z)-3,4-dimethylhept-3-ene;ethane;propane?
The InChIKey is IUNNIYGROFWIDC-ULDSSAIZSA-N. The full InChI is InChI=1S/C9H18.C3H8.C2H6/c1-5-7-9(4)8(3)6-2;1-3-2;1-2/h5-7H2,1-4H3;3H2,1-2H3;1-2H3/b9-8-;;.
What are the key properties of (Z)-3,4-dimethylhept-3-ene;ethane;propane?
(Z)-3,4-dimethylhept-3-ene;ethane;propane has a molecular weight of 200.41 g/mol, XLogP of 5.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-dimethylhept-3-ene;ethane;propane is sourced from PubChem (CID 144674690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).