About 2,3-dimethylpent-2-ene;propane
2,3-dimethylpent-2-ene;propane (PubChem CID 162031516) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is 2,3-dimethylpent-2-ene;propane.
Molecular Properties
| Compound Name | 2,3-dimethylpent-2-ene;propane |
| PubChem CID | 162031516 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | 2,3-dimethylpent-2-ene;propane |
| SMILES | CCC.CCC.CCC(C)=C(C)C |
| InChI | InChI=1S/C7H14.2C3H8/c1-5-7(4)6(2)3;2*1-3-2/h5H2,1-4H3;2*3H2,1-2H3 |
| InChIKey | YWBVMMJMZCBAFO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylpent-2-ene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpent-2-ene;propane?
The IUPAC name of 2,3-dimethylpent-2-ene;propane (CID 162031516) is 2,3-dimethylpent-2-ene;propane.
What is the SMILES notation for 2,3-dimethylpent-2-ene;propane?
The canonical SMILES for 2,3-dimethylpent-2-ene;propane is CCC.CCC.CCC(C)=C(C)C.
What is the InChIKey of 2,3-dimethylpent-2-ene;propane?
The InChIKey is YWBVMMJMZCBAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.2C3H8/c1-5-7(4)6(2)3;2*1-3-2/h5H2,1-4H3;2*3H2,1-2H3.
What are the key properties of 2,3-dimethylpent-2-ene;propane?
2,3-dimethylpent-2-ene;propane has a molecular weight of 186.38 g/mol, XLogP of 5.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpent-2-ene;propane is sourced from PubChem (CID 162031516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).