C13H28 — CID 143938090
(3E)-3-ethyl-4-methylhexa-1,3-diene;methane;propane (PubChem CID 143938090) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is (3E)-3-ethyl-4-methylhexa-1,3-diene;methane;propane.
| Compound Name | (3E)-3-ethyl-4-methylhexa-1,3-diene;methane;propane |
|---|---|
| PubChem CID | 143938090 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | (3E)-3-ethyl-4-methylhexa-1,3-diene;methane;propane |
| SMILES | C.C=C/C(CC)=C(\C)CC.CCC |
| InChI | InChI=1S/C9H16.C3H8.CH4/c1-5-8(4)9(6-2)7-3;1-3-2;/h6H,2,5,7H2,1,3-4H3;3H2,1-2H3;1H4/b9-8-;; |
| InChIKey | NAZWZGYDIKNOKX-ULDSSAIZSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|