C18H36 — CID 145156103
ethane;2-methylbuta-1,3-diene;(3Z)-2,3,4-trimethylhexa-1,3-diene (PubChem CID 145156103) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is ethane;2-methylbuta-1,3-diene;(3Z)-2,3,4-trimethylhexa-1,3-diene.
| Compound Name | ethane;2-methylbuta-1,3-diene;(3Z)-2,3,4-trimethylhexa-1,3-diene |
|---|---|
| PubChem CID | 145156103 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | ethane;2-methylbuta-1,3-diene;(3Z)-2,3,4-trimethylhexa-1,3-diene |
| SMILES | C=C(C)/C(C)=C(/C)CC.C=CC(=C)C.CC.CC |
| InChI | InChI=1S/C9H16.C5H8.2C2H6/c1-6-8(4)9(5)7(2)3;1-4-5(2)3;2*1-2/h2,6H2,1,3-5H3;4H,1-2H2,3H3;2*1-2H3/b9-8-;;; |
| InChIKey | QRACTRZLNOXDQM-DQNNFYOXSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|