C11H18O — CID 126639403
(3E,4Z)-3-ethylidene-4,5-dimethylhepta-1,4-dien-2-ol (PubChem CID 126639403) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-4,5-dimethylhepta-1,4-dien-2-ol.
| Compound Name | (3E,4Z)-3-ethylidene-4,5-dimethylhepta-1,4-dien-2-ol |
|---|---|
| PubChem CID | 126639403 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3E,4Z)-3-ethylidene-4,5-dimethylhepta-1,4-dien-2-ol |
| SMILES | C=C(O)C(=C/C)/C(C)=C(/C)CC |
| InChI | InChI=1S/C11H18O/c1-6-8(3)9(4)11(7-2)10(5)12/h7,12H,5-6H2,1-4H3/b9-8-,11-7+ |
| InChIKey | UIFOLBGPFHVJBN-NVKZJLNYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|