C14H24 — CID 141018531
(4E,7Z)-4-ethylidene-7,8-dimethyldeca-1,7-diene (PubChem CID 141018531) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (4E,7Z)-4-ethylidene-7,8-dimethyldeca-1,7-diene.
| Compound Name | (4E,7Z)-4-ethylidene-7,8-dimethyldeca-1,7-diene |
|---|---|
| PubChem CID | 141018531 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (4E,7Z)-4-ethylidene-7,8-dimethyldeca-1,7-diene |
| SMILES | C=CC/C(=C/C)CC/C(C)=C(/C)CC |
| InChI | InChI=1S/C14H24/c1-6-9-14(8-3)11-10-13(5)12(4)7-2/h6,8H,1,7,9-11H2,2-5H3/b13-12-,14-8- |
| InChIKey | ZEWHGJYYWINRGJ-QRRSZZECSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|