About 4-ethylidene-6,7-dimethylnona-1,6-diene
4-ethylidene-6,7-dimethylnona-1,6-diene (PubChem CID 54551976) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 4-ethylidene-6,7-dimethylnona-1,6-diene.
Molecular Properties
| Compound Name | 4-ethylidene-6,7-dimethylnona-1,6-diene |
| PubChem CID | 54551976 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 4-ethylidene-6,7-dimethylnona-1,6-diene |
| SMILES | C=CCC(=CC)CC(C)=C(C)CC |
| InChI | InChI=1S/C13H22/c1-6-9-13(8-3)10-12(5)11(4)7-2/h6,8H,1,7,9-10H2,2-5H3 |
| InChIKey | ZKNNSVGJXBRHRN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylidene-6,7-dimethylnona-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylidene-6,7-dimethylnona-1,6-diene?
The IUPAC name of 4-ethylidene-6,7-dimethylnona-1,6-diene (CID 54551976) is 4-ethylidene-6,7-dimethylnona-1,6-diene.
What is the SMILES notation for 4-ethylidene-6,7-dimethylnona-1,6-diene?
The canonical SMILES for 4-ethylidene-6,7-dimethylnona-1,6-diene is C=CCC(=CC)CC(C)=C(C)CC.
What is the InChIKey of 4-ethylidene-6,7-dimethylnona-1,6-diene?
The InChIKey is ZKNNSVGJXBRHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-6-9-13(8-3)10-12(5)11(4)7-2/h6,8H,1,7,9-10H2,2-5H3.
What are the key properties of 4-ethylidene-6,7-dimethylnona-1,6-diene?
4-ethylidene-6,7-dimethylnona-1,6-diene has a molecular weight of 178.32 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylidene-6,7-dimethylnona-1,6-diene is sourced from PubChem (CID 54551976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).