C14H22 — CID 91411455
4-ethylidene-6-propan-2-ylidenenona-1,7-diene (PubChem CID 91411455) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 4-ethylidene-6-propan-2-ylidenenona-1,7-diene.
| Compound Name | 4-ethylidene-6-propan-2-ylidenenona-1,7-diene |
|---|---|
| PubChem CID | 91411455 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 4-ethylidene-6-propan-2-ylidenenona-1,7-diene |
| SMILES | C=CCC(=CC)CC(C=CC)=C(C)C |
| InChI | InChI=1S/C14H22/c1-6-9-13(8-3)11-14(10-7-2)12(4)5/h6-8,10H,1,9,11H2,2-5H3 |
| InChIKey | YCNDYWLOBCIFQU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|