C12H18 — CID 142247806
(6E,8Z)-7-methyl-4-methylidenedeca-1,6,8-triene (PubChem CID 142247806) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (6E,8Z)-7-methyl-4-methylidenedeca-1,6,8-triene.
| Compound Name | (6E,8Z)-7-methyl-4-methylidenedeca-1,6,8-triene |
|---|---|
| PubChem CID | 142247806 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (6E,8Z)-7-methyl-4-methylidenedeca-1,6,8-triene |
| SMILES | C=CCC(=C)C/C=C(C)/C=C\C |
| InChI | InChI=1S/C12H18/c1-5-7-11(3)9-10-12(4)8-6-2/h5-6,8,10H,1,3,7,9H2,2,4H3/b8-6-,12-10+ |
| InChIKey | LLLOOQHOLGYBLC-DEOFSOSHSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|