C11H16O — CID 143148481
acetylene;(4Z,6Z)-5-methylocta-4,6-dien-2-one (PubChem CID 143148481) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is acetylene;(4Z,6Z)-5-methylocta-4,6-dien-2-one.
| Compound Name | acetylene;(4Z,6Z)-5-methylocta-4,6-dien-2-one |
|---|---|
| PubChem CID | 143148481 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | acetylene;(4Z,6Z)-5-methylocta-4,6-dien-2-one |
| SMILES | C#C.C/C=C\C(C)=C/CC(C)=O |
| InChI | InChI=1S/C9H14O.C2H2/c1-4-5-8(2)6-7-9(3)10;1-2/h4-6H,7H2,1-3H3;1-2H/b5-4-,8-6-; |
| InChIKey | BHRIMCWINGWKQB-PRWWQMKWSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|