C12H19N — CID 145229389
(2Z,4Z)-5-methyl-N-prop-2-enylocta-2,4,7-trien-4-amine (PubChem CID 145229389) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2Z,4Z)-5-methyl-N-prop-2-enylocta-2,4,7-trien-4-amine.
| Compound Name | (2Z,4Z)-5-methyl-N-prop-2-enylocta-2,4,7-trien-4-amine |
|---|---|
| PubChem CID | 145229389 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2Z,4Z)-5-methyl-N-prop-2-enylocta-2,4,7-trien-4-amine |
| SMILES | C=CCNC(/C=C\C)=C(/C)CC=C |
| InChI | InChI=1S/C12H19N/c1-5-8-11(4)12(9-6-2)13-10-7-3/h5-7,9,13H,1,3,8,10H2,2,4H3/b9-6-,12-11- |
| InChIKey | DBWSZTSIMQLKHE-KTXOSSPPSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|