C11H21N — CID 142945126
(4Z,6Z)-4-ethylocta-1,4,6-triene;methanamine (PubChem CID 142945126) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (4Z,6Z)-4-ethylocta-1,4,6-triene;methanamine.
| Compound Name | (4Z,6Z)-4-ethylocta-1,4,6-triene;methanamine |
|---|---|
| PubChem CID | 142945126 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (4Z,6Z)-4-ethylocta-1,4,6-triene;methanamine |
| SMILES | C=CC/C(=C\C=C/C)CC.CN |
| InChI | InChI=1S/C10H16.CH5N/c1-4-7-9-10(6-3)8-5-2;1-2/h4-5,7,9H,2,6,8H2,1,3H3;2H2,1H3/b7-4-,10-9-; |
| InChIKey | VVOXHZKPEDFOIQ-DBDVFUPWSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|