C11H20 — CID 142893307
ethane;(4E,6Z)-4-methylocta-1,4,6-triene (PubChem CID 142893307) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is ethane;(4E,6Z)-4-methylocta-1,4,6-triene.
| Compound Name | ethane;(4E,6Z)-4-methylocta-1,4,6-triene |
|---|---|
| PubChem CID | 142893307 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | ethane;(4E,6Z)-4-methylocta-1,4,6-triene |
| SMILES | C=CC/C(C)=C/C=C\C.CC |
| InChI | InChI=1S/C9H14.C2H6/c1-4-6-8-9(3)7-5-2;1-2/h4-6,8H,2,7H2,1,3H3;1-2H3/b6-4-,9-8+; |
| InChIKey | YYTVVCLYFZOMPG-DCVUVSDRSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|