C15H22 — CID 141042265
10-methyltetradeca-2,4,7,9,12-pentaene (PubChem CID 141042265) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 10-methyltetradeca-2,4,7,9,12-pentaene.
| Compound Name | 10-methyltetradeca-2,4,7,9,12-pentaene |
|---|---|
| PubChem CID | 141042265 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 10-methyltetradeca-2,4,7,9,12-pentaene |
| SMILES | CC=CC=CCC=CC=C(C)CC=CC |
| InChI | InChI=1S/C15H22/c1-4-6-8-9-10-11-12-14-15(3)13-7-5-2/h4-9,11-12,14H,10,13H2,1-3H3 |
| InChIKey | GXAFMTHVBNSNHE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|