C11H17N — CID 167138679
(Z)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]but-2-en-1-imine (PubChem CID 167138679) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (Z)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]but-2-en-1-imine.
| Compound Name | (Z)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 167138679 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (Z)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]but-2-en-1-imine |
| SMILES | C/C=C\C=N\C/C(C)=C/C=C\C |
| InChI | InChI=1S/C11H17N/c1-4-6-8-11(3)10-12-9-7-5-2/h4-9H,10H2,1-3H3/b6-4-,7-5-,11-8+,12-9+ |
| InChIKey | BAPNJUDPVYTSPS-MQHORPBMSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|