C13H23N — CID 178092345
3-methyl-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]pentan-2-imine (PubChem CID 178092345) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 3-methyl-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]pentan-2-imine.
| Compound Name | 3-methyl-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 178092345 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3-methyl-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]pentan-2-imine |
| SMILES | C/C=C\C=C(/C)C/N=C(\C)C(C)CC |
| InChI | InChI=1S/C13H23N/c1-6-8-9-11(3)10-14-13(5)12(4)7-2/h6,8-9,12H,7,10H2,1-5H3/b8-6-,11-9+,14-13+ |
| InChIKey | XQBSEWXLUJUREH-GLYDDASCSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|