C9H11ClO — CID 89302839
(2E,4Z)-2-prop-2-enylhexa-2,4-dienoyl chloride (PubChem CID 89302839) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is (2E,4Z)-2-prop-2-enylhexa-2,4-dienoyl chloride.
| Compound Name | (2E,4Z)-2-prop-2-enylhexa-2,4-dienoyl chloride |
|---|---|
| PubChem CID | 89302839 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (2E,4Z)-2-prop-2-enylhexa-2,4-dienoyl chloride |
| SMILES | C=CC/C(=C\C=C/C)C(=O)Cl |
| InChI | InChI=1S/C9H11ClO/c1-3-5-7-8(6-4-2)9(10)11/h3-5,7H,2,6H2,1H3/b5-3-,8-7+ |
| InChIKey | RDUNDFOSYOFTRU-ZIQCHISCSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|