C11H18 — CID 143978470
ethane;(5E)-3-ethenylhepta-1,3,5-triene (PubChem CID 143978470) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is ethane;(5E)-3-ethenylhepta-1,3,5-triene.
| Compound Name | ethane;(5E)-3-ethenylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143978470 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | ethane;(5E)-3-ethenylhepta-1,3,5-triene |
| SMILES | C=CC(C=C)=C/C=C/C.CC |
| InChI | InChI=1S/C9H12.C2H6/c1-4-7-8-9(5-2)6-3;1-2/h4-8H,2-3H2,1H3;1-2H3/b7-4+; |
| InChIKey | OSDCEMRTSGAHEN-KQGICBIGSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|