C18H27N — CID 142960447
ethane;(2E,4Z)-2-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hepta-2,4-dien-1-imine (PubChem CID 142960447) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hepta-2,4-dien-1-imine.
| Compound Name | ethane;(2E,4Z)-2-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142960447 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | ethane;(2E,4Z)-2-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hepta-2,4-dien-1-imine |
| SMILES | C=CC(/C=N\C(C=C)=C\C=C/C)=C\C=C/CC.CC |
| InChI | InChI=1S/C16H21N.C2H6/c1-5-9-11-12-15(7-3)14-17-16(8-4)13-10-6-2;1-2/h6-14H,3-5H2,1-2H3;1-2H3/b10-6-,11-9-,15-12+,16-13+,17-14+; |
| InChIKey | IPQOPKVPGGKZME-BLDSCQJUSA-N |
| XLogP | 5.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|