C12H19N — CID 118616221
(Z)-N-[(3Z)-penta-1,3-dien-3-yl]hept-4-en-1-imine (PubChem CID 118616221) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (Z)-N-[(3Z)-penta-1,3-dien-3-yl]hept-4-en-1-imine.
| Compound Name | (Z)-N-[(3Z)-penta-1,3-dien-3-yl]hept-4-en-1-imine |
|---|---|
| PubChem CID | 118616221 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (Z)-N-[(3Z)-penta-1,3-dien-3-yl]hept-4-en-1-imine |
| SMILES | C=CC(=C/C)/N=C/CC/C=C\CC |
| InChI | InChI=1S/C12H19N/c1-4-7-8-9-10-11-13-12(5-2)6-3/h5-8,11H,2,4,9-10H2,1,3H3/b8-7-,12-6-,13-11+ |
| InChIKey | FNXQPZJPTSGDBY-XRVPFVKSSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|