C14H28 — CID 142182203
ethane;(3Z,5Z)-3-propan-2-ylhepta-1,3,5-triene (PubChem CID 142182203) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is ethane;(3Z,5Z)-3-propan-2-ylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-3-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142182203 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | ethane;(3Z,5Z)-3-propan-2-ylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C/C)C(C)C.CC.CC |
| InChI | InChI=1S/C10H16.2C2H6/c1-5-7-8-10(6-2)9(3)4;2*1-2/h5-9H,2H2,1,3-4H3;2*1-2H3/b7-5-,10-8+;; |
| InChIKey | INLQGCNGFCEJOG-RTZYNNLGSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|