C10H17N — CID 126626487
(1Z,3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-1-amine (PubChem CID 126626487) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (1Z,3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 126626487 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (1Z,3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C=C(/C=C\N)C(C)C |
| InChI | InChI=1S/C10H17N/c1-4-5-6-10(7-8-11)9(2)3/h4-9H,11H2,1-3H3/b5-4-,8-7-,10-6+ |
| InChIKey | IYOHGLLRLOEURZ-VGEZGYKQSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|