C7H12N2 — CID 134355562
(1Z,3E,5Z)-hepta-1,3,5-triene-1,3-diamine (PubChem CID 134355562) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (1Z,3E,5Z)-hepta-1,3,5-triene-1,3-diamine.
| Compound Name | (1Z,3E,5Z)-hepta-1,3,5-triene-1,3-diamine |
|---|---|
| PubChem CID | 134355562 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (1Z,3E,5Z)-hepta-1,3,5-triene-1,3-diamine |
| SMILES | C/C=C\C=C(N)/C=C\N |
| InChI | InChI=1S/C7H12N2/c1-2-3-4-7(9)5-6-8/h2-6H,8-9H2,1H3/b3-2-,6-5-,7-4+ |
| InChIKey | NOCYARZZNOSKMP-SDXWXUEJSA-N |
| XLogP | 0.88 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|