C8H13N — CID 88966128
(1E,3Z,5Z)-4-methylhepta-1,3,5-trien-1-amine (PubChem CID 88966128) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (1E,3Z,5Z)-4-methylhepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-4-methylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88966128 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (1E,3Z,5Z)-4-methylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C(C)=C/C=C/N |
| InChI | InChI=1S/C8H13N/c1-3-5-8(2)6-4-7-9/h3-7H,9H2,1-2H3/b5-3-,7-4+,8-6- |
| InChIKey | CNFNDSQBMPHLPH-KCGRKFFMSA-N |
| XLogP | 1.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|