C11H16FN — CID 146550324
(1Z,3E,5Z,7E)-8-fluoro-4,7-dimethylnona-1,3,5,7-tetraen-1-amine (PubChem CID 146550324) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (1Z,3E,5Z,7E)-8-fluoro-4,7-dimethylnona-1,3,5,7-tetraen-1-amine.
| Compound Name | (1Z,3E,5Z,7E)-8-fluoro-4,7-dimethylnona-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 146550324 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (1Z,3E,5Z,7E)-8-fluoro-4,7-dimethylnona-1,3,5,7-tetraen-1-amine |
| SMILES | CC(/C=C\C(C)=C(/C)F)=C\C=C/N |
| InChI | InChI=1S/C11H16FN/c1-9(5-4-8-13)6-7-10(2)11(3)12/h4-8H,13H2,1-3H3/b7-6-,8-4-,9-5+,11-10+ |
| InChIKey | VDEULFCPGVISNB-ABULRWQDSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|