C6H15N3 — CID 144743431
(3Z)-buta-1,3-diene-1,1,4-triamine;ethane (PubChem CID 144743431) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is (3Z)-buta-1,3-diene-1,1,4-triamine;ethane.
| Compound Name | (3Z)-buta-1,3-diene-1,1,4-triamine;ethane |
|---|---|
| PubChem CID | 144743431 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | (3Z)-buta-1,3-diene-1,1,4-triamine;ethane |
| SMILES | CC.N/C=C\C=C(N)N |
| InChI | InChI=1S/C4H9N3.C2H6/c5-3-1-2-4(6)7;1-2/h1-3H,5-7H2;1-2H3/b3-1-; |
| InChIKey | RCDQMPVHLWMEHJ-SPNQZIMRSA-N |
| XLogP | 0.24 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|