C12H21N — CID 145186821
ethane;(1Z,3Z,6Z)-6-ethenylocta-1,3,6-trien-1-amine (PubChem CID 145186821) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is ethane;(1Z,3Z,6Z)-6-ethenylocta-1,3,6-trien-1-amine.
| Compound Name | ethane;(1Z,3Z,6Z)-6-ethenylocta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 145186821 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | ethane;(1Z,3Z,6Z)-6-ethenylocta-1,3,6-trien-1-amine |
| SMILES | C=C/C(=C\C)C/C=C\C=C/N.CC |
| InChI | InChI=1S/C10H15N.C2H6/c1-3-10(4-2)8-6-5-7-9-11;1-2/h3-7,9H,1,8,11H2,2H3;1-2H3/b6-5-,9-7-,10-4+; |
| InChIKey | MWOLUOQCVRIOSP-UBONGQBJSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|