C13H27Cl — CID 144532054
(3E)-3-(chloromethyl)penta-1,3-diene;ethane;prop-1-ene (PubChem CID 144532054) has the molecular formula C13H27Cl and a molecular weight of 218.81 g/mol. Its IUPAC name is (3E)-3-(chloromethyl)penta-1,3-diene;ethane;prop-1-ene.
| Compound Name | (3E)-3-(chloromethyl)penta-1,3-diene;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144532054 |
| Molecular Formula | C13H27Cl |
| Molecular Weight | 218.81 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3E)-3-(chloromethyl)penta-1,3-diene;ethane;prop-1-ene |
| SMILES | C=C/C(=C\C)CCl.C=CC.CC.CC |
| InChI | InChI=1S/C6H9Cl.C3H6.2C2H6/c1-3-6(4-2)5-7;1-3-2;2*1-2/h3-4H,1,5H2,2H3;3H,1H2,2H3;2*1-2H3/b6-4+;;; |
| InChIKey | YEAJXOSTRFKAHK-VFKQLSEOSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|