C8H12 — CID 85441048
4-ethenylhexa-1,4-diene (PubChem CID 85441048) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is 4-ethenylhexa-1,4-diene.
| Compound Name | 4-ethenylhexa-1,4-diene |
|---|---|
| PubChem CID | 85441048 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 4-ethenylhexa-1,4-diene |
| SMILES | C=CCC(C=C)=CC |
| InChI | InChI=1S/C8H12/c1-4-7-8(5-2)6-3/h4-6H,1-2,7H2,3H3 |
| InChIKey | SKRAXGVWRNVSIJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|