C13H18 — CID 151010728
4-ethylideneundeca-1,5,7,9-tetraene (PubChem CID 151010728) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 4-ethylideneundeca-1,5,7,9-tetraene.
| Compound Name | 4-ethylideneundeca-1,5,7,9-tetraene |
|---|---|
| PubChem CID | 151010728 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 4-ethylideneundeca-1,5,7,9-tetraene |
| SMILES | C=CCC(C=CC=CC=CC)=CC |
| InChI | InChI=1S/C13H18/c1-4-7-8-9-10-12-13(6-3)11-5-2/h4-10,12H,2,11H2,1,3H3 |
| InChIKey | LWAOPDKJLFCHSC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|